C9H15N3O4S — CID 79467002
2-amino-4-(1,3-dihydroxypropan-2-ylamino)benzenesulfonamide (PubChem CID 79467002) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is 2-amino-4-(1,3-dihydroxypropan-2-ylamino)benzenesulfonamide.
| Compound Name | 2-amino-4-(1,3-dihydroxypropan-2-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 79467002 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-amino-4-(1,3-dihydroxypropan-2-ylamino)benzenesulfonamide |
| SMILES | Nc1cc(NC(CO)CO)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C9H15N3O4S/c10-8-3-6(12-7(4-13)5-14)1-2-9(8)17(11,15)16/h1-3,7,12-14H,4-5,10H2,(H2,11,15,16) |
| InChIKey | MZSZIAGYARXOCF-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|