C12H10ClN3OS — CID 171705381
5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine (PubChem CID 171705381) has the molecular formula C12H10ClN3OS and a molecular weight of 279.75 g/mol. Its IUPAC name is 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine.
| Compound Name | 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 171705381 |
| Molecular Formula | C12H10ClN3OS |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine |
| SMILES | Clc1ccc2oc(NCCc3nccs3)nc2c1 |
| InChI | InChI=1S/C12H10ClN3OS/c13-8-1-2-10-9(7-8)16-12(17-10)15-4-3-11-14-5-6-18-11/h1-2,5-7H,3-4H2,(H,15,16) |
| InChIKey | ZRBSRQCHNHRWHM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |