About 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine
5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine (PubChem CID 171705381) has the molecular formula C12H10ClN3OS
and a molecular weight of 279.75 g/mol. Its IUPAC name is 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine.
Molecular Properties
| Compound Name | 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine |
| PubChem CID | 171705381 |
| Molecular Formula | C12H10ClN3OS |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine |
| SMILES | Clc1ccc2oc(NCCc3nccs3)nc2c1 |
| InChI | InChI=1S/C12H10ClN3OS/c13-8-1-2-10-9(7-8)16-12(17-10)15-4-3-11-14-5-6-18-11/h1-2,5-7H,3-4H2,(H,15,16) |
| InChIKey | ZRBSRQCHNHRWHM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine?
The IUPAC name of 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine (CID 171705381) is 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine.
What is the SMILES notation for 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine?
The canonical SMILES for 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine is Clc1ccc2oc(NCCc3nccs3)nc2c1.
What is the InChIKey of 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine?
The InChIKey is ZRBSRQCHNHRWHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN3OS/c13-8-1-2-10-9(7-8)16-12(17-10)15-4-3-11-14-5-6-18-11/h1-2,5-7H,3-4H2,(H,15,16).
What are the key properties of 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine?
5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine has a molecular weight of 279.75 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[2-(1,3-thiazol-2-yl)ethyl]-1,3-benzoxazol-2-amine is sourced from PubChem (CID 171705381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).