C20H20ClN3O3S — CID 22719561
2-(chloromethyl)-N-[4-methoxy-7-(oxan-4-yl)-1,3-benzothiazol-2-yl]pyridine-4-carboxamide (PubChem CID 22719561) has the molecular formula C20H20ClN3O3S and a molecular weight of 417.92 g/mol. Its IUPAC name is 2-(chloromethyl)-N-[4-methoxy-7-(oxan-4-yl)-1,3-benzothiazol-2-yl]pyridine-4-carboxamide.
| Compound Name | 2-(chloromethyl)-N-[4-methoxy-7-(oxan-4-yl)-1,3-benzothiazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 22719561 |
| Molecular Formula | C20H20ClN3O3S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-(chloromethyl)-N-[4-methoxy-7-(oxan-4-yl)-1,3-benzothiazol-2-yl]pyridine-4-carboxamide |
| SMILES | COc1ccc(C2CCOCC2)c2sc(NC(=O)c3ccnc(CCl)c3)nc12 |
| InChI | InChI=1S/C20H20ClN3O3S/c1-26-16-3-2-15(12-5-8-27-9-6-12)18-17(16)23-20(28-18)24-19(25)13-4-7-22-14(10-13)11-21/h2-4,7,10,12H,5-6,8-9,11H2,1H3,(H,23,24,25) |
| InChIKey | QDMYFLDWDRNRAO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|