C19H18BrN3O4 — CID 22252232
2-bromo-N-[4-methoxy-7-(oxan-4-yl)-1,3-benzoxazol-2-yl]pyridine-4-carboxamide (PubChem CID 22252232) has the molecular formula C19H18BrN3O4 and a molecular weight of 432.27 g/mol. Its IUPAC name is 2-bromo-N-[4-methoxy-7-(oxan-4-yl)-1,3-benzoxazol-2-yl]pyridine-4-carboxamide.
| Compound Name | 2-bromo-N-[4-methoxy-7-(oxan-4-yl)-1,3-benzoxazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 22252232 |
| Molecular Formula | C19H18BrN3O4 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 2-bromo-N-[4-methoxy-7-(oxan-4-yl)-1,3-benzoxazol-2-yl]pyridine-4-carboxamide |
| SMILES | COc1ccc(C2CCOCC2)c2oc(NC(=O)c3ccnc(Br)c3)nc12 |
| InChI | InChI=1S/C19H18BrN3O4/c1-25-14-3-2-13(11-5-8-26-9-6-11)17-16(14)22-19(27-17)23-18(24)12-4-7-21-15(20)10-12/h2-4,7,10-11H,5-6,8-9H2,1H3,(H,22,23,24) |
| InChIKey | QCMZBUOCLFOUTA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|