C11H12N2O4 — CID 142921913
methyl N-(4-methoxy-7-methyl-1,3-benzoxazol-2-yl)carbamate (PubChem CID 142921913) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is methyl N-(4-methoxy-7-methyl-1,3-benzoxazol-2-yl)carbamate.
| Compound Name | methyl N-(4-methoxy-7-methyl-1,3-benzoxazol-2-yl)carbamate |
|---|---|
| PubChem CID | 142921913 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | methyl N-(4-methoxy-7-methyl-1,3-benzoxazol-2-yl)carbamate |
| SMILES | COC(=O)Nc1nc2c(OC)ccc(C)c2o1 |
| InChI | InChI=1S/C11H12N2O4/c1-6-4-5-7(15-2)8-9(6)17-10(12-8)13-11(14)16-3/h4-5H,1-3H3,(H,12,13,14) |
| InChIKey | AXNLAQBNUFZYII-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |