C16H16F3N3O3 — CID 151258808
2,2,2-trifluoro-N-[8-methoxy-5-(oxan-4-yl)quinoxalin-2-yl]acetamide (PubChem CID 151258808) has the molecular formula C16H16F3N3O3 and a molecular weight of 355.32 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[8-methoxy-5-(oxan-4-yl)quinoxalin-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[8-methoxy-5-(oxan-4-yl)quinoxalin-2-yl]acetamide |
|---|---|
| PubChem CID | 151258808 |
| Molecular Formula | C16H16F3N3O3 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[8-methoxy-5-(oxan-4-yl)quinoxalin-2-yl]acetamide |
| SMILES | COc1ccc(C2CCOCC2)c2ncc(NC(=O)C(F)(F)F)nc12 |
| InChI | InChI=1S/C16H16F3N3O3/c1-24-11-3-2-10(9-4-6-25-7-5-9)13-14(11)21-12(8-20-13)22-15(23)16(17,18)19/h2-3,8-9H,4-7H2,1H3,(H,21,22,23) |
| InChIKey | NTXPNJSGXHJLMB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |