C26H33N3O4 — CID 170142220
N-[8-methoxy-5-(oxan-4-yl)quinoxalin-2-yl]-2-(3-oxaspiro[5.5]undec-9-en-10-yl)acetamide (PubChem CID 170142220) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-[8-methoxy-5-(oxan-4-yl)quinoxalin-2-yl]-2-(3-oxaspiro[5.5]undec-9-en-10-yl)acetamide.
| Compound Name | N-[8-methoxy-5-(oxan-4-yl)quinoxalin-2-yl]-2-(3-oxaspiro[5.5]undec-9-en-10-yl)acetamide |
|---|---|
| PubChem CID | 170142220 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | N-[8-methoxy-5-(oxan-4-yl)quinoxalin-2-yl]-2-(3-oxaspiro[5.5]undec-9-en-10-yl)acetamide |
| SMILES | COc1ccc(C2CCOCC2)c2ncc(NC(=O)CC3=CCCC4(CCOCC4)C3)nc12 |
| InChI | InChI=1S/C26H33N3O4/c1-31-21-5-4-20(19-6-11-32-12-7-19)24-25(21)29-22(17-27-24)28-23(30)15-18-3-2-8-26(16-18)9-13-33-14-10-26/h3-5,17,19H,2,6-16H2,1H3,(H,28,29,30) |
| InChIKey | VDWGYNMDUHOJNW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|