C22H23ClN2O2S — CID 22719560
4-(chloromethyl)-N-(7-cyclohexyl-4-methoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 22719560) has the molecular formula C22H23ClN2O2S and a molecular weight of 414.96 g/mol. Its IUPAC name is 4-(chloromethyl)-N-(7-cyclohexyl-4-methoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-(chloromethyl)-N-(7-cyclohexyl-4-methoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 22719560 |
| Molecular Formula | C22H23ClN2O2S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 4-(chloromethyl)-N-(7-cyclohexyl-4-methoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | COc1ccc(C2CCCCC2)c2sc(NC(=O)c3ccc(CCl)cc3)nc12 |
| InChI | InChI=1S/C22H23ClN2O2S/c1-27-18-12-11-17(15-5-3-2-4-6-15)20-19(18)24-22(28-20)25-21(26)16-9-7-14(13-23)8-10-16/h7-12,15H,2-6,13H2,1H3,(H,24,25,26) |
| InChIKey | XLLZRFULFUYRIG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|