C14H19N5O3S2 — CID 18139411
ethyl 2-[2-[[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 18139411) has the molecular formula C14H19N5O3S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is ethyl 2-[2-[[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 18139411 |
| Molecular Formula | C14H19N5O3S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | ethyl 2-[2-[[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)Nc1nc(CC(=O)OCC)cs1 |
| InChI | InChI=1S/C14H19N5O3S2/c1-3-5-10-17-18-14(23)19(10)7-11(20)16-13-15-9(8-24-13)6-12(21)22-4-2/h8H,3-7H2,1-2H3,(H,18,23)(H,15,16,20) |
| InChIKey | AGNPYZQHWCOXDK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|