C13H15N5O5S — CID 19521289
ethyl 2-[2-[[2-(5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 19521289) has the molecular formula C13H15N5O5S and a molecular weight of 353.36 g/mol. Its IUPAC name is ethyl 2-[2-[[2-(5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[2-(5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 19521289 |
| Molecular Formula | C13H15N5O5S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | ethyl 2-[2-[[2-(5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)Cn2nc([N+](=O)[O-])cc2C)n1 |
| InChI | InChI=1S/C13H15N5O5S/c1-3-23-12(20)5-9-7-24-13(14-9)15-11(19)6-17-8(2)4-10(16-17)18(21)22/h4,7H,3,5-6H2,1-2H3,(H,14,15,19) |
| InChIKey | IVSFVLRZDTUSFE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|