C14H21N5OS2 — CID 24648463
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 24648463) has the molecular formula C14H21N5OS2 and a molecular weight of 339.49 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 24648463 |
| Molecular Formula | C14H21N5OS2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)Nc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C14H21N5OS2/c1-5-6-10-17-18-13(21)19(10)7-11(20)16-12-15-9(8-22-12)14(2,3)4/h8H,5-7H2,1-4H3,(H,18,21)(H,15,16,20) |
| InChIKey | KLIPEEQANDCKBI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|