C16H24N4OS2 — CID 98557343
N-[(1R)-2,2-dimethyl-1-thiophen-2-ylpropyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 98557343) has the molecular formula C16H24N4OS2 and a molecular weight of 352.53 g/mol. Its IUPAC name is N-[(1R)-2,2-dimethyl-1-thiophen-2-ylpropyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-[(1R)-2,2-dimethyl-1-thiophen-2-ylpropyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 98557343 |
| Molecular Formula | C16H24N4OS2 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[(1R)-2,2-dimethyl-1-thiophen-2-ylpropyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)N[C@@H](c1cccs1)C(C)(C)C |
| InChI | InChI=1S/C16H24N4OS2/c1-5-7-12-18-19-15(22)20(12)10-13(21)17-14(16(2,3)4)11-8-6-9-23-11/h6,8-9,14H,5,7,10H2,1-4H3,(H,17,21)(H,19,22)/t14-/m0/s1 |
| InChIKey | QJLFXWUJIDDXQI-AWEZNQCLSA-N |
| XLogP | 3.86 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|