C17H25N5O2S2 — CID 43043697
N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 43043697) has the molecular formula C17H25N5O2S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 43043697 |
| Molecular Formula | C17H25N5O2S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C17H25N5O2S2/c1-2-4-15-19-20-17(25)22(15)12-16(23)18-11-13(14-5-3-10-26-14)21-6-8-24-9-7-21/h3,5,10,13H,2,4,6-9,11-12H2,1H3,(H,18,23)(H,20,25) |
| InChIKey | LRCFQMADJCTFLT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|