C20H22ClN5O2S2 — CID 42919324
2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)acetamide (PubChem CID 42919324) has the molecular formula C20H22ClN5O2S2 and a molecular weight of 464.02 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 42919324 |
| Molecular Formula | C20H22ClN5O2S2 |
| Molecular Weight | 464.02 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(Cn1c(-c2ccc(Cl)cc2)n[nH]c1=S)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C20H22ClN5O2S2/c21-15-5-3-14(4-6-15)19-23-24-20(29)26(19)13-18(27)22-12-16(17-2-1-11-30-17)25-7-9-28-10-8-25/h1-6,11,16H,7-10,12-13H2,(H,22,27)(H,24,29) |
| InChIKey | DJDIHXTZXFCVOG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.02 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|