C21H24N4OS2 — CID 18230089
N-[4-(3,4-dimethylphenyl)sulfanylphenyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 18230089) has the molecular formula C21H24N4OS2 and a molecular weight of 412.58 g/mol. Its IUPAC name is N-[4-(3,4-dimethylphenyl)sulfanylphenyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-[4-(3,4-dimethylphenyl)sulfanylphenyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 18230089 |
| Molecular Formula | C21H24N4OS2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-[4-(3,4-dimethylphenyl)sulfanylphenyl]-2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)Nc1ccc(Sc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C21H24N4OS2/c1-4-5-19-23-24-21(27)25(19)13-20(26)22-16-7-10-17(11-8-16)28-18-9-6-14(2)15(3)12-18/h6-12H,4-5,13H2,1-3H3,(H,22,26)(H,24,27) |
| InChIKey | XMKXFNYWHFLPPD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|