C15H19N5O2S — CID 46657014
2-methyl-N'-[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]benzohydrazide (PubChem CID 46657014) has the molecular formula C15H19N5O2S and a molecular weight of 333.42 g/mol. Its IUPAC name is 2-methyl-N'-[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]benzohydrazide.
| Compound Name | 2-methyl-N'-[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 46657014 |
| Molecular Formula | C15H19N5O2S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-methyl-N'-[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]benzohydrazide |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)NNC(=O)c1ccccc1C |
| InChI | InChI=1S/C15H19N5O2S/c1-3-6-12-16-19-15(23)20(12)9-13(21)17-18-14(22)11-8-5-4-7-10(11)2/h4-5,7-8H,3,6,9H2,1-2H3,(H,17,21)(H,18,22)(H,19,23) |
| InChIKey | DUCDQPQSLPORIP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|