C15H18FN5O2S — CID 31726048
2-(4-fluorophenyl)-N'-[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]acetohydrazide (PubChem CID 31726048) has the molecular formula C15H18FN5O2S and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N'-[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]acetohydrazide.
| Compound Name | 2-(4-fluorophenyl)-N'-[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 31726048 |
| Molecular Formula | C15H18FN5O2S |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-(4-fluorophenyl)-N'-[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]acetohydrazide |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)NNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H18FN5O2S/c1-2-3-12-17-20-15(24)21(12)9-14(23)19-18-13(22)8-10-4-6-11(16)7-5-10/h4-7H,2-3,8-9H2,1H3,(H,18,22)(H,19,23)(H,20,24) |
| InChIKey | FSENDGVYPGKKKN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|