C7H11N3O2S — CID 4962445
2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetic acid (PubChem CID 4962445) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetic acid.
| Compound Name | 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 4962445 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetic acid |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)O |
| InChI | InChI=1S/C7H11N3O2S/c1-2-3-5-8-9-7(13)10(5)4-6(11)12/h2-4H2,1H3,(H,9,13)(H,11,12) |
| InChIKey | XMKLBQBIIALMQA-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|