C8H15N3O2S2 — CID 60918125
4-(2-methylsulfonylethyl)-3-propyl-1H-1,2,4-triazole-5-thione (PubChem CID 60918125) has the molecular formula C8H15N3O2S2 and a molecular weight of 249.36 g/mol. Its IUPAC name is 4-(2-methylsulfonylethyl)-3-propyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-methylsulfonylethyl)-3-propyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 60918125 |
| Molecular Formula | C8H15N3O2S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 4-(2-methylsulfonylethyl)-3-propyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCc1n[nH]c(=S)n1CCS(C)(=O)=O |
| InChI | InChI=1S/C8H15N3O2S2/c1-3-4-7-9-10-8(14)11(7)5-6-15(2,12)13/h3-6H2,1-2H3,(H,10,14) |
| InChIKey | ZVQAXLWBUSGCRR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|