C14H19N5O3S — CID 30712190
N-[2-[[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]ethyl]furan-2-carboxamide (PubChem CID 30712190) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is N-[2-[[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 30712190 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-[2-[[2-(3-propyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)acetyl]amino]ethyl]furan-2-carboxamide |
| SMILES | CCCc1n[nH]c(=S)n1CC(=O)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C14H19N5O3S/c1-2-4-11-17-18-14(23)19(11)9-12(20)15-6-7-16-13(21)10-5-3-8-22-10/h3,5,8H,2,4,6-7,9H2,1H3,(H,15,20)(H,16,21)(H,18,23) |
| InChIKey | FGKWYOJOBQWYDK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|