C29H24N2O2S — CID 16583700
N-[4-(3,4-dimethylphenyl)sulfanylphenyl]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 16583700) has the molecular formula C29H24N2O2S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[4-(3,4-dimethylphenyl)sulfanylphenyl]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[4-(3,4-dimethylphenyl)sulfanylphenyl]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 16583700 |
| Molecular Formula | C29H24N2O2S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-[4-(3,4-dimethylphenyl)sulfanylphenyl]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | Cc1ccc(Sc2ccc(NC(=O)Cn3c4ccccc4c(=O)c4ccccc43)cc2)cc1C |
| InChI | InChI=1S/C29H24N2O2S/c1-19-11-14-23(17-20(19)2)34-22-15-12-21(13-16-22)30-28(32)18-31-26-9-5-3-7-24(26)29(33)25-8-4-6-10-27(25)31/h3-17H,18H2,1-2H3,(H,30,32) |
| InChIKey | JHUBCKGXMPPOJC-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|