C19H17ClN8OS2 — CID 24683287
2-(3-chlorophenyl)-5-methyl-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]triazole-4-carboxamide (PubChem CID 24683287) has the molecular formula C19H17ClN8OS2 and a molecular weight of 472.99 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-methyl-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]triazole-4-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-5-methyl-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 24683287 |
| Molecular Formula | C19H17ClN8OS2 |
| Molecular Weight | 472.99 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 2-(3-chlorophenyl)-5-methyl-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]triazole-4-carboxamide |
| SMILES | C=CCn1c(Cc2csc(NC(=O)c3nn(-c4cccc(Cl)c4)nc3C)n2)n[nH]c1=S |
| InChI | InChI=1S/C19H17ClN8OS2/c1-3-7-27-15(23-24-19(27)30)9-13-10-31-18(21-13)22-17(29)16-11(2)25-28(26-16)14-6-4-5-12(20)8-14/h3-6,8,10H,1,7,9H2,2H3,(H,24,30)(H,21,22,29) |
| InChIKey | LZFZXJYOQFGHAQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.99 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|