C21H21N7O2S2 — CID 24683362
3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]propanamide (PubChem CID 24683362) has the molecular formula C21H21N7O2S2 and a molecular weight of 467.58 g/mol. Its IUPAC name is 3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 24683362 |
| Molecular Formula | C21H21N7O2S2 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]propanamide |
| SMILES | C=CCn1c(Cc2csc(NC(=O)CCc3nnc(-c4ccc(C)cc4)o3)n2)n[nH]c1=S |
| InChI | InChI=1S/C21H21N7O2S2/c1-3-10-28-16(24-27-21(28)31)11-15-12-32-20(22-15)23-17(29)8-9-18-25-26-19(30-18)14-6-4-13(2)5-7-14/h3-7,12H,1,8-11H2,2H3,(H,27,31)(H,22,23,29) |
| InChIKey | JVLCLJBWKIZDAU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|