C19H21N5OS3 — CID 24683310
2-(4-methylphenyl)sulfanyl-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]propanamide (PubChem CID 24683310) has the molecular formula C19H21N5OS3 and a molecular weight of 431.61 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfanyl-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-(4-methylphenyl)sulfanyl-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 24683310 |
| Molecular Formula | C19H21N5OS3 |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2-(4-methylphenyl)sulfanyl-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]propanamide |
| SMILES | C=CCn1c(Cc2csc(NC(=O)C(C)Sc3ccc(C)cc3)n2)n[nH]c1=S |
| InChI | InChI=1S/C19H21N5OS3/c1-4-9-24-16(22-23-19(24)26)10-14-11-27-18(20-14)21-17(25)13(3)28-15-7-5-12(2)6-8-15/h4-8,11,13H,1,9-10H2,2-3H3,(H,23,26)(H,20,21,25) |
| InChIKey | FXSISTPWEXGUPT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|