C24H28N6O2S2 — CID 43059116
1-(4-butylphenyl)-5-oxo-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide (PubChem CID 43059116) has the molecular formula C24H28N6O2S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is 1-(4-butylphenyl)-5-oxo-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(4-butylphenyl)-5-oxo-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 43059116 |
| Molecular Formula | C24H28N6O2S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 1-(4-butylphenyl)-5-oxo-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]pyrrolidine-3-carboxamide |
| SMILES | C=CCn1c(Cc2csc(NC(=O)C3CC(=O)N(c4ccc(CCCC)cc4)C3)n2)n[nH]c1=S |
| InChI | InChI=1S/C24H28N6O2S2/c1-3-5-6-16-7-9-19(10-8-16)30-14-17(12-21(30)31)22(32)26-23-25-18(15-34-23)13-20-27-28-24(33)29(20)11-4-2/h4,7-10,15,17H,2-3,5-6,11-14H2,1H3,(H,28,33)(H,25,26,32) |
| InChIKey | MASPBAZMWWMEGU-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|