C21H23N7OS3 — CID 24683418
2-[2,5-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)pyrrol-1-yl]-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 24683418) has the molecular formula C21H23N7OS3 and a molecular weight of 485.66 g/mol. Its IUPAC name is 2-[2,5-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)pyrrol-1-yl]-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[2,5-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)pyrrol-1-yl]-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 24683418 |
| Molecular Formula | C21H23N7OS3 |
| Molecular Weight | 485.66 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 2-[2,5-dimethyl-3-(2-methyl-1,3-thiazol-4-yl)pyrrol-1-yl]-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | C=CCn1c(Cc2csc(NC(=O)Cn3c(C)cc(-c4csc(C)n4)c3C)n2)n[nH]c1=S |
| InChI | InChI=1S/C21H23N7OS3/c1-5-6-27-18(25-26-21(27)30)8-15-10-32-20(23-15)24-19(29)9-28-12(2)7-16(13(28)3)17-11-31-14(4)22-17/h5,7,10-11H,1,6,8-9H2,2-4H3,(H,26,30)(H,23,24,29) |
| InChIKey | WPYPGJPPMNXLSD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.66 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|