C19H20N8OS2 — CID 37153932
1,3,6-trimethyl-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 37153932) has the molecular formula C19H20N8OS2 and a molecular weight of 440.56 g/mol. Its IUPAC name is 1,3,6-trimethyl-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 1,3,6-trimethyl-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 37153932 |
| Molecular Formula | C19H20N8OS2 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 1,3,6-trimethyl-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | C=CCn1c(Cc2csc(NC(=O)c3cc4c(C)nn(C)c4nc3C)n2)n[nH]c1=S |
| InChI | InChI=1S/C19H20N8OS2/c1-5-6-27-15(23-24-19(27)29)7-12-9-30-18(21-12)22-17(28)14-8-13-11(3)25-26(4)16(13)20-10(14)2/h5,8-9H,1,6-7H2,2-4H3,(H,24,29)(H,21,22,28) |
| InChIKey | LJFZIRYCIVPEQV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|