C18H18N8OS2 — CID 78846112
1,3-dimethyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]pyrazolo[5,4-b]pyridine-5-carboxamide (PubChem CID 78846112) has the molecular formula C18H18N8OS2 and a molecular weight of 426.53 g/mol. Its IUPAC name is 1,3-dimethyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]pyrazolo[5,4-b]pyridine-5-carboxamide.
| Compound Name | 1,3-dimethyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]pyrazolo[5,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 78846112 |
| Molecular Formula | C18H18N8OS2 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 1,3-dimethyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]pyrazolo[5,4-b]pyridine-5-carboxamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)c3cnc4c(c3)c(C)nn4C)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C18H18N8OS2/c1-5-6-26-15(22-23-18(26)28)13-10(3)20-17(29-13)21-16(27)11-7-12-9(2)24-25(4)14(12)19-8-11/h5,7-8H,1,6H2,2-4H3,(H,23,28)(H,20,21,27) |
| InChIKey | MBNWNXARDLLBTD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|