C20H19N7OS2 — CID 55824810
5-methyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-1-phenylpyrazole-3-carboxamide (PubChem CID 55824810) has the molecular formula C20H19N7OS2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 5-methyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-1-phenylpyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55824810 |
| Molecular Formula | C20H19N7OS2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 5-methyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-1-phenylpyrazole-3-carboxamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)c3cc(C)n(-c4ccccc4)n3)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C20H19N7OS2/c1-4-10-26-17(23-24-20(26)29)16-13(3)21-19(30-16)22-18(28)15-11-12(2)27(25-15)14-8-6-5-7-9-14/h4-9,11H,1,10H2,2-3H3,(H,24,29)(H,21,22,28) |
| InChIKey | DSLBOEHUNRHWFJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|