C19H22N6OS2 — CID 55862042
2-(N-ethylanilino)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 55862042) has the molecular formula C19H22N6OS2 and a molecular weight of 414.56 g/mol. Its IUPAC name is 2-(N-ethylanilino)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(N-ethylanilino)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 55862042 |
| Molecular Formula | C19H22N6OS2 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 2-(N-ethylanilino)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)CN(CC)c3ccccc3)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C19H22N6OS2/c1-4-11-25-17(22-23-19(25)27)16-13(3)20-18(28-16)21-15(26)12-24(5-2)14-9-7-6-8-10-14/h4,6-10H,1,5,11-12H2,2-3H3,(H,23,27)(H,20,21,26) |
| InChIKey | HMAVLHCIVGYJID-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|