C22H20N6OS2 — CID 56577659
2-anilino-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 56577659) has the molecular formula C22H20N6OS2 and a molecular weight of 448.58 g/mol. Its IUPAC name is 2-anilino-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2-anilino-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 56577659 |
| Molecular Formula | C22H20N6OS2 |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 2-anilino-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)c3ccccc3Nc3ccccc3)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C22H20N6OS2/c1-3-13-28-19(26-27-22(28)30)18-14(2)23-21(31-18)25-20(29)16-11-7-8-12-17(16)24-15-9-5-4-6-10-15/h3-12,24H,1,13H2,2H3,(H,27,30)(H,23,25,29) |
| InChIKey | WEVIOZMNLPQSMM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|