C17H19N5OS3 — CID 55537018
5-ethyl-4-methyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]thiophene-2-carboxamide (PubChem CID 55537018) has the molecular formula C17H19N5OS3 and a molecular weight of 405.57 g/mol. Its IUPAC name is 5-ethyl-4-methyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-ethyl-4-methyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55537018 |
| Molecular Formula | C17H19N5OS3 |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 5-ethyl-4-methyl-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]thiophene-2-carboxamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)c3cc(C)c(CC)s3)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C17H19N5OS3/c1-5-7-22-14(20-21-17(22)24)13-10(4)18-16(26-13)19-15(23)12-8-9(3)11(6-2)25-12/h5,8H,1,6-7H2,2-4H3,(H,21,24)(H,18,19,23) |
| InChIKey | XJHDYGXDIZOZFP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|