C19H15ClN6O2S2 — CID 24667446
5-(4-chlorophenyl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide (PubChem CID 24667446) has the molecular formula C19H15ClN6O2S2 and a molecular weight of 458.96 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 24667446 |
| Molecular Formula | C19H15ClN6O2S2 |
| Molecular Weight | 458.96 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-1,2-oxazole-3-carboxamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)c3cc(-c4ccc(Cl)cc4)on3)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C19H15ClN6O2S2/c1-3-8-26-16(23-24-19(26)29)15-10(2)21-18(30-15)22-17(27)13-9-14(28-25-13)11-4-6-12(20)7-5-11/h3-7,9H,1,8H2,2H3,(H,24,29)(H,21,22,27) |
| InChIKey | OHQWYPXQFBZBKI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.96 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|