C18H19N7O3S2 — CID 24667398
4-(dimethylamino)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-3-nitrobenzamide (PubChem CID 24667398) has the molecular formula C18H19N7O3S2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-3-nitrobenzamide.
| Compound Name | 4-(dimethylamino)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 24667398 |
| Molecular Formula | C18H19N7O3S2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 4-(dimethylamino)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)c3ccc(N(C)C)c([N+](=O)[O-])c3)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C18H19N7O3S2/c1-5-8-24-15(21-22-18(24)29)14-10(2)19-17(30-14)20-16(26)11-6-7-12(23(3)4)13(9-11)25(27)28/h5-7,9H,1,8H2,2-4H3,(H,22,29)(H,19,20,26) |
| InChIKey | WSLQBXLEUQXGMG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|