C23H19N7OS2 — CID 24659493
4-(benzimidazol-1-yl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 24659493) has the molecular formula C23H19N7OS2 and a molecular weight of 473.59 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(benzimidazol-1-yl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 24659493 |
| Molecular Formula | C23H19N7OS2 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 4-(benzimidazol-1-yl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)c3ccc(-n4cnc5ccccc54)cc3)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C23H19N7OS2/c1-3-12-29-20(27-28-23(29)32)19-14(2)25-22(33-19)26-21(31)15-8-10-16(11-9-15)30-13-24-17-6-4-5-7-18(17)30/h3-11,13H,1,12H2,2H3,(H,28,32)(H,25,26,31) |
| InChIKey | HNMWONXQGCJBLP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|