C21H23N5O3S2 — CID 36864990
4-(4-acetylphenoxy)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]butanamide (PubChem CID 36864990) has the molecular formula C21H23N5O3S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 4-(4-acetylphenoxy)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(4-acetylphenoxy)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 36864990 |
| Molecular Formula | C21H23N5O3S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 4-(4-acetylphenoxy)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]butanamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)CCCOc3ccc(C(C)=O)cc3)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C21H23N5O3S2/c1-4-11-26-19(24-25-21(26)30)18-13(2)22-20(31-18)23-17(28)6-5-12-29-16-9-7-15(8-10-16)14(3)27/h4,7-10H,1,5-6,11-12H2,2-3H3,(H,25,30)(H,22,23,28) |
| InChIKey | XLXMKOZLBCBBNV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|