C17H21N7OS2 — CID 24672658
3-(3,5-dimethylpyrazol-1-yl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]propanamide (PubChem CID 24672658) has the molecular formula C17H21N7OS2 and a molecular weight of 403.54 g/mol. Its IUPAC name is 3-(3,5-dimethylpyrazol-1-yl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 24672658 |
| Molecular Formula | C17H21N7OS2 |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]propanamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)CCn3nc(C)cc3C)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C17H21N7OS2/c1-5-7-23-15(20-21-17(23)26)14-12(4)18-16(27-14)19-13(25)6-8-24-11(3)9-10(2)22-24/h5,9H,1,6-8H2,2-4H3,(H,21,26)(H,18,19,25) |
| InChIKey | POAZTGZERJEWJP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|