C15H14N6O2S2 — CID 24659477
N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 24659477) has the molecular formula C15H14N6O2S2 and a molecular weight of 374.45 g/mol. Its IUPAC name is N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24659477 |
| Molecular Formula | C15H14N6O2S2 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)c3ccc(=O)[nH]c3)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C15H14N6O2S2/c1-3-6-21-12(19-20-15(21)24)11-8(2)17-14(25-11)18-13(23)9-4-5-10(22)16-7-9/h3-5,7H,1,6H2,2H3,(H,16,22)(H,20,24)(H,17,18,23) |
| InChIKey | LXLWUDRAXBXLES-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|