C24H19N5OS2 — CID 24667439
N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-4-(2-phenylethynyl)benzamide (PubChem CID 24667439) has the molecular formula C24H19N5OS2 and a molecular weight of 457.58 g/mol. Its IUPAC name is N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-4-(2-phenylethynyl)benzamide.
| Compound Name | N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-4-(2-phenylethynyl)benzamide |
|---|---|
| PubChem CID | 24667439 |
| Molecular Formula | C24H19N5OS2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-4-(2-phenylethynyl)benzamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)c3ccc(C#Cc4ccccc4)cc3)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C24H19N5OS2/c1-3-15-29-21(27-28-24(29)31)20-16(2)25-23(32-20)26-22(30)19-13-11-18(12-14-19)10-9-17-7-5-4-6-8-17/h3-8,11-14H,1,15H2,2H3,(H,28,31)(H,25,26,30) |
| InChIKey | PMUWLBGUDVNOOI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|