C16H13F2N5OS2 — CID 25470252
2,5-difluoro-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 25470252) has the molecular formula C16H13F2N5OS2 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2,5-difluoro-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2,5-difluoro-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 25470252 |
| Molecular Formula | C16H13F2N5OS2 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 2,5-difluoro-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)c3cc(F)ccc3F)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C16H13F2N5OS2/c1-3-6-23-13(21-22-16(23)25)12-8(2)19-15(26-12)20-14(24)10-7-9(17)4-5-11(10)18/h3-5,7H,1,6H2,2H3,(H,22,25)(H,19,20,24) |
| InChIKey | DJERKGOMHDDOLP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|