C23H22FN7OS2 — CID 46548453
1-(4-fluorophenyl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 46548453) has the molecular formula C23H22FN7OS2 and a molecular weight of 495.61 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 46548453 |
| Molecular Formula | C23H22FN7OS2 |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)c3nn(-c4ccc(F)cc4)c4c3CCCC4)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C23H22FN7OS2/c1-3-12-30-20(27-28-23(30)33)19-13(2)25-22(34-19)26-21(32)18-16-6-4-5-7-17(16)31(29-18)15-10-8-14(24)9-11-15/h3,8-11H,1,4-7,12H2,2H3,(H,28,33)(H,25,26,32) |
| InChIKey | WUFMQOQQQBKBGV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|