C18H17N5O2S2 — CID 134039867
N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-2,3-dihydro-1-benzofuran-2-carboxamide (PubChem CID 134039867) has the molecular formula C18H17N5O2S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-2,3-dihydro-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-2,3-dihydro-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 134039867 |
| Molecular Formula | C18H17N5O2S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | N-[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]-2,3-dihydro-1-benzofuran-2-carboxamide |
| SMILES | C=CCn1c(-c2sc(NC(=O)C3Cc4ccccc4O3)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C18H17N5O2S2/c1-3-8-23-15(21-22-18(23)26)14-10(2)19-17(27-14)20-16(24)13-9-11-6-4-5-7-12(11)25-13/h3-7,13H,1,8-9H2,2H3,(H,22,26)(H,19,20,24) |
| InChIKey | QWCYOMCPFRNEFA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|