C20H28N6O3S2 — CID 24667432
tert-butyl 3-[[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 24667432) has the molecular formula C20H28N6O3S2 and a molecular weight of 464.62 g/mol. Its IUPAC name is tert-butyl 3-[[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24667432 |
| Molecular Formula | C20H28N6O3S2 |
| Molecular Weight | 464.62 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | tert-butyl 3-[[4-methyl-5-(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-1,3-thiazol-2-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | C=CCn1c(-c2sc(NC(=O)C3CCCN(C(=O)OC(C)(C)C)C3)nc2C)n[nH]c1=S |
| InChI | InChI=1S/C20H28N6O3S2/c1-6-9-26-15(23-24-18(26)30)14-12(2)21-17(31-14)22-16(27)13-8-7-10-25(11-13)19(28)29-20(3,4)5/h6,13H,1,7-11H2,2-5H3,(H,24,30)(H,21,22,27) |
| InChIKey | CMXGGCRQLGHQCN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.62 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|