C19H20N6O3S2 — CID 33331373
ethyl N-[3-[[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]carbamate (PubChem CID 33331373) has the molecular formula C19H20N6O3S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is ethyl N-[3-[[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 33331373 |
| Molecular Formula | C19H20N6O3S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | ethyl N-[3-[[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]carbamate |
| SMILES | C=CCn1c(Cc2csc(NC(=O)c3cccc(NC(=O)OCC)c3)n2)n[nH]c1=S |
| InChI | InChI=1S/C19H20N6O3S2/c1-3-8-25-15(23-24-18(25)29)10-14-11-30-17(20-14)22-16(26)12-6-5-7-13(9-12)21-19(27)28-4-2/h3,5-7,9,11H,1,4,8,10H2,2H3,(H,21,27)(H,24,29)(H,20,22,26) |
| InChIKey | HUGWRDJSYBCZGI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|