C18H18ClN5O2S2 — CID 32960323
(2R)-2-(4-chlorophenoxy)-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]propanamide (PubChem CID 32960323) has the molecular formula C18H18ClN5O2S2 and a molecular weight of 435.96 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenoxy)-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]propanamide.
| Compound Name | (2R)-2-(4-chlorophenoxy)-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 32960323 |
| Molecular Formula | C18H18ClN5O2S2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | (2R)-2-(4-chlorophenoxy)-N-[4-[(4-prop-2-enyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]propanamide |
| SMILES | C=CCn1c(Cc2csc(NC(=O)[C@@H](C)Oc3ccc(Cl)cc3)n2)n[nH]c1=S |
| InChI | InChI=1S/C18H18ClN5O2S2/c1-3-8-24-15(22-23-18(24)27)9-13-10-28-17(20-13)21-16(25)11(2)26-14-6-4-12(19)5-7-14/h3-7,10-11H,1,8-9H2,2H3,(H,23,27)(H,20,21,25)/t11-/m1/s1 |
| InChIKey | BPUVVWMFKRCOCQ-LLVKDONJSA-N |
| XLogP | 4.23 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|