C20H23N7O3S2 — CID 46579367
4-(4-methylpiperidin-1-yl)-N-[4-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]-3-nitrobenzamide (PubChem CID 46579367) has the molecular formula C20H23N7O3S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 4-(4-methylpiperidin-1-yl)-N-[4-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]-3-nitrobenzamide.
| Compound Name | 4-(4-methylpiperidin-1-yl)-N-[4-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 46579367 |
| Molecular Formula | C20H23N7O3S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 4-(4-methylpiperidin-1-yl)-N-[4-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-1,3-thiazol-2-yl]-3-nitrobenzamide |
| SMILES | CC1CCN(c2ccc(C(=O)Nc3nc(Cc4n[nH]c(=S)n4C)cs3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H23N7O3S2/c1-12-5-7-26(8-6-12)15-4-3-13(9-16(15)27(29)30)18(28)22-19-21-14(11-32-19)10-17-23-24-20(31)25(17)2/h3-4,9,11-12H,5-8,10H2,1-2H3,(H,24,31)(H,21,22,28) |
| InChIKey | WISGQDBKJIQJSX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|