C12H9Cl2N3O3S — CID 104986172
methyl 2-[2-[(2,5-dichloropyridine-4-carbonyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 104986172) has the molecular formula C12H9Cl2N3O3S and a molecular weight of 346.20 g/mol. Its IUPAC name is methyl 2-[2-[(2,5-dichloropyridine-4-carbonyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-[(2,5-dichloropyridine-4-carbonyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 104986172 |
| Molecular Formula | C12H9Cl2N3O3S |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | methyl 2-[2-[(2,5-dichloropyridine-4-carbonyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(NC(=O)c2cc(Cl)ncc2Cl)n1 |
| InChI | InChI=1S/C12H9Cl2N3O3S/c1-20-10(18)2-6-5-21-12(16-6)17-11(19)7-3-9(14)15-4-8(7)13/h3-5H,2H2,1H3,(H,16,17,19) |
| InChIKey | VFTZCKCZNXZOOA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|