C17H16N4O3S2 — CID 52725730
N-[5-(methanesulfonamido)-1,3,4-thiadiazol-2-yl]-2,2-diphenylacetamide (PubChem CID 52725730) has the molecular formula C17H16N4O3S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[5-(methanesulfonamido)-1,3,4-thiadiazol-2-yl]-2,2-diphenylacetamide.
| Compound Name | N-[5-(methanesulfonamido)-1,3,4-thiadiazol-2-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 52725730 |
| Molecular Formula | C17H16N4O3S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-[5-(methanesulfonamido)-1,3,4-thiadiazol-2-yl]-2,2-diphenylacetamide |
| SMILES | CS(=O)(=O)Nc1nnc(NC(=O)C(c2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C17H16N4O3S2/c1-26(23,24)21-17-20-19-16(25-17)18-15(22)14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11,14H,1H3,(H,20,21)(H,18,19,22) |
| InChIKey | FRFZFECQSMJNBF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |