C23H22N4O3S — CID 2955149
N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide (PubChem CID 2955149) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 2955149 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanamide |
| SMILES | CCCCc1nnc(NC(=O)C(Cc2ccccc2)N2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C23H22N4O3S/c1-2-3-13-19-25-26-23(31-19)24-20(28)18(14-15-9-5-4-6-10-15)27-21(29)16-11-7-8-12-17(16)22(27)30/h4-12,18H,2-3,13-14H2,1H3,(H,24,26,28) |
| InChIKey | SRNDCYVUIKOJDO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|