C29H31N7O3 — CID 118622478
N-[6-[4-[2-oxo-4-[[(1R)-1-phenylethyl]carbamoylamino]pyrimidin-1-yl]butyl]pyridazin-3-yl]-2-phenylacetamide (PubChem CID 118622478) has the molecular formula C29H31N7O3 and a molecular weight of 525.61 g/mol. Its IUPAC name is N-[6-[4-[2-oxo-4-[[(1R)-1-phenylethyl]carbamoylamino]pyrimidin-1-yl]butyl]pyridazin-3-yl]-2-phenylacetamide.
| Compound Name | N-[6-[4-[2-oxo-4-[[(1R)-1-phenylethyl]carbamoylamino]pyrimidin-1-yl]butyl]pyridazin-3-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 118622478 |
| Molecular Formula | C29H31N7O3 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | N-[6-[4-[2-oxo-4-[[(1R)-1-phenylethyl]carbamoylamino]pyrimidin-1-yl]butyl]pyridazin-3-yl]-2-phenylacetamide |
| SMILES | C[C@@H](NC(=O)Nc1ccn(CCCCc2ccc(NC(=O)Cc3ccccc3)nn2)c(=O)n1)c1ccccc1 |
| InChI | InChI=1S/C29H31N7O3/c1-21(23-12-6-3-7-13-23)30-28(38)32-25-17-19-36(29(39)33-25)18-9-8-14-24-15-16-26(35-34-24)31-27(37)20-22-10-4-2-5-11-22/h2-7,10-13,15-17,19,21H,8-9,14,18,20H2,1H3,(H,31,35,37)(H2,30,32,33,38,39)/t21-/m1/s1 |
| InChIKey | ALUSPZXEYKIAEH-OAQYLSRUSA-N |
| XLogP | 4.12 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|